C13H21N4O2+ — CID 11935947
(Z)-(diaminomethylideneamino)-[[3-methoxy-4-(2-methylpropoxy)phenyl]methylidene]azanium (PubChem CID 11935947) has the molecular formula C13H21N4O2+ and a molecular weight of 265.34 g/mol. Its IUPAC name is (Z)-(diaminomethylideneamino)-[[3-methoxy-4-(2-methylpropoxy)phenyl]methylidene]azanium.
| Compound Name | (Z)-(diaminomethylideneamino)-[[3-methoxy-4-(2-methylpropoxy)phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 11935947 |
| Molecular Formula | C13H21N4O2+ |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (Z)-(diaminomethylideneamino)-[[3-methoxy-4-(2-methylpropoxy)phenyl]methylidene]azanium |
| SMILES | COc1cc(/C=[NH+]\N=C(N)N)ccc1OCC(C)C |
| InChI | InChI=1S/C13H20N4O2/c1-9(2)8-19-11-5-4-10(6-12(11)18-3)7-16-17-13(14)15/h4-7,9H,8H2,1-3H3,(H4,14,15,17)/p+1/b16-7- |
| InChIKey | OTTTYXHGBPKACF-APSNUPSMSA-O |
| XLogP | -0.58 |
| TPSA | 96.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|