C18H21N4O5+ — CID 9058127
(E)-(diaminomethylideneamino)-[[4-(3,4-dimethoxybenzoyl)oxy-3-methoxyphenyl]methylidene]azanium (PubChem CID 9058127) has the molecular formula C18H21N4O5+ and a molecular weight of 373.39 g/mol. Its IUPAC name is (E)-(diaminomethylideneamino)-[[4-(3,4-dimethoxybenzoyl)oxy-3-methoxyphenyl]methylidene]azanium.
| Compound Name | (E)-(diaminomethylideneamino)-[[4-(3,4-dimethoxybenzoyl)oxy-3-methoxyphenyl]methylidene]azanium |
|---|---|
| PubChem CID | 9058127 |
| Molecular Formula | C18H21N4O5+ |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (E)-(diaminomethylideneamino)-[[4-(3,4-dimethoxybenzoyl)oxy-3-methoxyphenyl]methylidene]azanium |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C=[NH+]/N=C(N)N)cc2OC)cc1OC |
| InChI | InChI=1S/C18H20N4O5/c1-24-13-7-5-12(9-16(13)26-3)17(23)27-14-6-4-11(8-15(14)25-2)10-21-22-18(19)20/h4-10H,1-3H3,(H4,19,20,22)/p+1/b21-10+ |
| InChIKey | IVIZLCDPXCISKV-UFFVCSGVSA-O |
| XLogP | -0.38 |
| TPSA | 132.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|