C12H15BrClFN2 — CID 169367535
N'-(2-bromo-4-tert-butyl-6-fluorophenyl)-2-chloroethanimidamide (PubChem CID 169367535) has the molecular formula C12H15BrClFN2 and a molecular weight of 321.62 g/mol. Its IUPAC name is N'-(2-bromo-4-tert-butyl-6-fluorophenyl)-2-chloroethanimidamide.
| Compound Name | N'-(2-bromo-4-tert-butyl-6-fluorophenyl)-2-chloroethanimidamide |
|---|---|
| PubChem CID | 169367535 |
| Molecular Formula | C12H15BrClFN2 |
| Molecular Weight | 321.62 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | N'-(2-bromo-4-tert-butyl-6-fluorophenyl)-2-chloroethanimidamide |
| SMILES | CC(C)(C)c1cc(F)c(/N=C(/N)CCl)c(Br)c1 |
| InChI | InChI=1S/C12H15BrClFN2/c1-12(2,3)7-4-8(13)11(9(15)5-7)17-10(16)6-14/h4-5H,6H2,1-3H3,(H2,16,17) |
| InChIKey | BJQKRBDLAULLRE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|