C10H11FN4OS — CID 3001792
N-[4-[(carbamothioylhydrazinylidene)methyl]-2-fluorophenyl]acetamide (PubChem CID 3001792) has the molecular formula C10H11FN4OS and a molecular weight of 254.29 g/mol. Its IUPAC name is N-[4-[(carbamothioylhydrazinylidene)methyl]-2-fluorophenyl]acetamide.
| Compound Name | N-[4-[(carbamothioylhydrazinylidene)methyl]-2-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 3001792 |
| Molecular Formula | C10H11FN4OS |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | N-[4-[(carbamothioylhydrazinylidene)methyl]-2-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C=NNC(N)=S)cc1F |
| InChI | InChI=1S/C10H11FN4OS/c1-6(16)14-9-3-2-7(4-8(9)11)5-13-15-10(12)17/h2-5H,1H3,(H,14,16)(H3,12,15,17) |
| InChIKey | LPOOMGIKZQEQHR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|