C18H19F2N5S — CID 76572529
[[3-fluoro-4-[4-(3-fluorophenyl)piperazin-1-yl]phenyl]methylideneamino]thiourea (PubChem CID 76572529) has the molecular formula C18H19F2N5S and a molecular weight of 375.45 g/mol. Its IUPAC name is [[3-fluoro-4-[4-(3-fluorophenyl)piperazin-1-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[3-fluoro-4-[4-(3-fluorophenyl)piperazin-1-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76572529 |
| Molecular Formula | C18H19F2N5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [[3-fluoro-4-[4-(3-fluorophenyl)piperazin-1-yl]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc(N2CCN(c3cccc(F)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C18H19F2N5S/c19-14-2-1-3-15(11-14)24-6-8-25(9-7-24)17-5-4-13(10-16(17)20)12-22-23-18(21)26/h1-5,10-12H,6-9H2,(H3,21,23,26) |
| InChIKey | MOMGLFZSTWMPQS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|