C24H25FN6S — CID 76572597
[[4-[6-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-3-pyridinyl]phenyl]methylideneamino]thiourea (PubChem CID 76572597) has the molecular formula C24H25FN6S and a molecular weight of 448.57 g/mol. Its IUPAC name is [[4-[6-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-3-pyridinyl]phenyl]methylideneamino]thiourea.
| Compound Name | [[4-[6-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-3-pyridinyl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76572597 |
| Molecular Formula | C24H25FN6S |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | [[4-[6-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]-3-pyridinyl]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc(-c2ccc(N3CCN(Cc4cccc(F)c4)CC3)nc2)cc1 |
| InChI | InChI=1S/C24H25FN6S/c25-22-3-1-2-19(14-22)17-30-10-12-31(13-11-30)23-9-8-21(16-27-23)20-6-4-18(5-7-20)15-28-29-24(26)32/h1-9,14-16H,10-13,17H2,(H3,26,29,32) |
| InChIKey | NAANFZRXYFDUKK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|