C20H23F2N5S — CID 76572021
[[2,5-difluoro-4-[4-[(3-methylphenyl)methyl]piperazin-1-yl]phenyl]methylideneamino]thiourea (PubChem CID 76572021) has the molecular formula C20H23F2N5S and a molecular weight of 403.50 g/mol. Its IUPAC name is [[2,5-difluoro-4-[4-[(3-methylphenyl)methyl]piperazin-1-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[2,5-difluoro-4-[4-[(3-methylphenyl)methyl]piperazin-1-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76572021 |
| Molecular Formula | C20H23F2N5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | [[2,5-difluoro-4-[4-[(3-methylphenyl)methyl]piperazin-1-yl]phenyl]methylideneamino]thiourea |
| SMILES | Cc1cccc(CN2CCN(c3cc(F)c(C=NNC(N)=S)cc3F)CC2)c1 |
| InChI | InChI=1S/C20H23F2N5S/c1-14-3-2-4-15(9-14)13-26-5-7-27(8-6-26)19-11-17(21)16(10-18(19)22)12-24-25-20(23)28/h2-4,9-12H,5-8,13H2,1H3,(H3,23,25,28) |
| InChIKey | WNYUNXUSXSGDSB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|