C18H20F2N6S — CID 76572512
[[2,5-difluoro-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea (PubChem CID 76572512) has the molecular formula C18H20F2N6S and a molecular weight of 390.46 g/mol. Its IUPAC name is [[2,5-difluoro-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[2,5-difluoro-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76572512 |
| Molecular Formula | C18H20F2N6S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | [[2,5-difluoro-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(F)c(N2CCN(Cc3ccccn3)CC2)cc1F |
| InChI | InChI=1S/C18H20F2N6S/c19-15-10-17(16(20)9-13(15)11-23-24-18(21)27)26-7-5-25(6-8-26)12-14-3-1-2-4-22-14/h1-4,9-11H,5-8,12H2,(H3,21,24,27) |
| InChIKey | AGBUZJYATZKVGQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|