C22H24F5N5OS — CID 76572258
[[2,5-difluoro-4-[4-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]piperidin-1-yl]phenyl]methylideneamino]thiourea (PubChem CID 76572258) has the molecular formula C22H24F5N5OS and a molecular weight of 501.53 g/mol. Its IUPAC name is [[2,5-difluoro-4-[4-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]piperidin-1-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[2,5-difluoro-4-[4-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]piperidin-1-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76572258 |
| Molecular Formula | C22H24F5N5OS |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | [[2,5-difluoro-4-[4-[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]piperidin-1-yl]phenyl]methylideneamino]thiourea |
| SMILES | CN(Cc1ccccc1OC(F)(F)F)C1CCN(c2cc(F)c(C=NNC(N)=S)cc2F)CC1 |
| InChI | InChI=1S/C22H24F5N5OS/c1-31(13-14-4-2-3-5-20(14)33-22(25,26)27)16-6-8-32(9-7-16)19-11-17(23)15(10-18(19)24)12-29-30-21(28)34/h2-5,10-12,16H,6-9,13H2,1H3,(H3,28,30,34) |
| InChIKey | KFRYYHVCMBQOTP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|