C25H32F2N6S — CID 91450793
[[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluoro-4-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]methylideneamino]thiourea (PubChem CID 91450793) has the molecular formula C25H32F2N6S and a molecular weight of 486.64 g/mol. Its IUPAC name is [[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluoro-4-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluoro-4-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 91450793 |
| Molecular Formula | C25H32F2N6S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | [[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluoro-4-[4-(4-fluorophenyl)piperidin-1-yl]phenyl]methylideneamino]thiourea |
| SMILES | CN(C)[C@@H]1CCN(c2cc(N3CCC(c4ccc(F)cc4)CC3)c(F)cc2C=NNC(N)=S)C1 |
| InChI | InChI=1S/C25H32F2N6S/c1-31(2)21-9-12-33(16-21)23-14-24(22(27)13-19(23)15-29-30-25(28)34)32-10-7-18(8-11-32)17-3-5-20(26)6-4-17/h3-6,13-15,18,21H,7-12,16H2,1-2H3,(H3,28,30,34)/t21-/m1/s1 |
| InChIKey | JTTISIMYKQKFKZ-OAQYLSRUSA-N |
| XLogP | 3.66 |
| TPSA | 60.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|