C26H41FN6S — CID 91578981
[[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-fluoro-4-(4-pentan-3-ylpiperazin-1-yl)phenyl]methylideneamino]thiourea (PubChem CID 91578981) has the molecular formula C26H41FN6S and a molecular weight of 488.72 g/mol. Its IUPAC name is [[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-fluoro-4-(4-pentan-3-ylpiperazin-1-yl)phenyl]methylideneamino]thiourea.
| Compound Name | [[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-fluoro-4-(4-pentan-3-ylpiperazin-1-yl)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 91578981 |
| Molecular Formula | C26H41FN6S |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | [[2-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-fluoro-4-(4-pentan-3-ylpiperazin-1-yl)phenyl]methylideneamino]thiourea |
| SMILES | CCC(CC)N1CCN(c2cc(N3CC[C@@H]4CCCC[C@@H]4C3)c(C=NNC(N)=S)cc2F)CC1 |
| InChI | InChI=1S/C26H41FN6S/c1-3-22(4-2)31-11-13-32(14-12-31)25-16-24(21(15-23(25)27)17-29-30-26(28)34)33-10-9-19-7-5-6-8-20(19)18-33/h15-17,19-20,22H,3-14,18H2,1-2H3,(H3,28,30,34)/t19-,20+/m0/s1 |
| InChIKey | RFESSUTZNMDWQM-VQTJNVASSA-N |
| XLogP | 4.32 |
| TPSA | 60.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|