C25H34FN7S — CID 76572627
[[4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylideneamino]thiourea (PubChem CID 76572627) has the molecular formula C25H34FN7S and a molecular weight of 483.66 g/mol. Its IUPAC name is [[4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylideneamino]thiourea.
| Compound Name | [[4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76572627 |
| Molecular Formula | C25H34FN7S |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | [[4-[4-(2,5-dimethylphenyl)piperazin-1-yl]-5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]methylideneamino]thiourea |
| SMILES | Cc1ccc(C)c(N2CCN(c3cc(N4CCN(C)CC4)c(C=NNC(N)=S)cc3F)CC2)c1 |
| InChI | InChI=1S/C25H34FN7S/c1-18-4-5-19(2)22(14-18)31-10-12-33(13-11-31)24-16-23(32-8-6-30(3)7-9-32)20(15-21(24)26)17-28-29-25(27)34/h4-5,14-17H,6-13H2,1-3H3,(H3,27,29,34) |
| InChIKey | NEBGGLWZYGUPJP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|