C21H26F4N8S — CID 149130821
[(Z)-[5-fluoro-2-(4-methylpiperazin-1-yl)-4-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]phenyl]methylideneamino]thiourea (PubChem CID 149130821) has the molecular formula C21H26F4N8S and a molecular weight of 498.55 g/mol. Its IUPAC name is [(Z)-[5-fluoro-2-(4-methylpiperazin-1-yl)-4-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]phenyl]methylideneamino]thiourea.
| Compound Name | [(Z)-[5-fluoro-2-(4-methylpiperazin-1-yl)-4-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 149130821 |
| Molecular Formula | C21H26F4N8S |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | [(Z)-[5-fluoro-2-(4-methylpiperazin-1-yl)-4-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethylamino]phenyl]methylideneamino]thiourea |
| SMILES | CN1CCN(c2cc(NCCNc3ccc(C(F)(F)F)cn3)c(F)cc2/C=N\NC(N)=S)CC1 |
| InChI | InChI=1S/C21H26F4N8S/c1-32-6-8-33(9-7-32)18-11-17(16(22)10-14(18)12-30-31-20(26)34)27-4-5-28-19-3-2-15(13-29-19)21(23,24)25/h2-3,10-13,27H,4-9H2,1H3,(H,28,29)(H3,26,31,34)/b30-12- |
| InChIKey | RCLPUABKBRQZMD-FTCYSYDXSA-N |
| XLogP | 2.68 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|