C12H14F3N3OS — CID 168536005
[[2-propoxy-5-(trifluoromethyl)phenyl]methylideneamino]thiourea (PubChem CID 168536005) has the molecular formula C12H14F3N3OS and a molecular weight of 305.33 g/mol. Its IUPAC name is [[2-propoxy-5-(trifluoromethyl)phenyl]methylideneamino]thiourea.
| Compound Name | [[2-propoxy-5-(trifluoromethyl)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 168536005 |
| Molecular Formula | C12H14F3N3OS |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | [[2-propoxy-5-(trifluoromethyl)phenyl]methylideneamino]thiourea |
| SMILES | CCCOc1ccc(C(F)(F)F)cc1C=NNC(N)=S |
| InChI | InChI=1S/C12H14F3N3OS/c1-2-5-19-10-4-3-9(12(13,14)15)6-8(10)7-17-18-11(16)20/h3-4,6-7H,2,5H2,1H3,(H3,16,18,20) |
| InChIKey | UJEPVHBMOIQYMS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|