C10H14BN3O3S — CID 168535099
[3-[(carbamothioylhydrazinylidene)methyl]-4-ethoxyphenyl]boronic acid (PubChem CID 168535099) has the molecular formula C10H14BN3O3S and a molecular weight of 267.12 g/mol. Its IUPAC name is [3-[(carbamothioylhydrazinylidene)methyl]-4-ethoxyphenyl]boronic acid.
| Compound Name | [3-[(carbamothioylhydrazinylidene)methyl]-4-ethoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 168535099 |
| Molecular Formula | C10H14BN3O3S |
| Molecular Weight | 267.12 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | [3-[(carbamothioylhydrazinylidene)methyl]-4-ethoxyphenyl]boronic acid |
| SMILES | CCOc1ccc(B(O)O)cc1C=NNC(N)=S |
| InChI | InChI=1S/C10H14BN3O3S/c1-2-17-9-4-3-8(11(15)16)5-7(9)6-13-14-10(12)18/h3-6,15-16H,2H2,1H3,(H3,12,14,18) |
| InChIKey | JJMSWFMBXUZFHM-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.12 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|