C24H31ClFN7S — CID 91504424
[[4-[4-(4-chlorophenyl)piperazin-1-yl]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluorophenyl]methylideneamino]thiourea (PubChem CID 91504424) has the molecular formula C24H31ClFN7S and a molecular weight of 504.08 g/mol. Its IUPAC name is [[4-[4-(4-chlorophenyl)piperazin-1-yl]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluorophenyl]methylideneamino]thiourea.
| Compound Name | [[4-[4-(4-chlorophenyl)piperazin-1-yl]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluorophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 91504424 |
| Molecular Formula | C24H31ClFN7S |
| Molecular Weight | 504.08 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | [[4-[4-(4-chlorophenyl)piperazin-1-yl]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluorophenyl]methylideneamino]thiourea |
| SMILES | CN(C)[C@@H]1CCN(c2cc(N3CCN(c4ccc(Cl)cc4)CC3)c(F)cc2C=NNC(N)=S)C1 |
| InChI | InChI=1S/C24H31ClFN7S/c1-30(2)20-7-8-33(16-20)22-14-23(21(26)13-17(22)15-28-29-24(27)34)32-11-9-31(10-12-32)19-5-3-18(25)4-6-19/h3-6,13-15,20H,7-12,16H2,1-2H3,(H3,27,29,34)/t20-/m1/s1 |
| InChIKey | MPLJSJHHSBCMHX-HXUWFJFHSA-N |
| XLogP | 3.11 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.08 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|