C25H30ClFN6OS — CID 91055518
[[4-[(3R,5S)-4-(4-chlorobenzoyl)-3,5-dimethylpiperazin-1-yl]-5-fluoro-2-pyrrolidin-1-ylphenyl]methylideneamino]thiourea (PubChem CID 91055518) has the molecular formula C25H30ClFN6OS and a molecular weight of 517.07 g/mol. Its IUPAC name is [[4-[(3R,5S)-4-(4-chlorobenzoyl)-3,5-dimethylpiperazin-1-yl]-5-fluoro-2-pyrrolidin-1-ylphenyl]methylideneamino]thiourea.
| Compound Name | [[4-[(3R,5S)-4-(4-chlorobenzoyl)-3,5-dimethylpiperazin-1-yl]-5-fluoro-2-pyrrolidin-1-ylphenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 91055518 |
| Molecular Formula | C25H30ClFN6OS |
| Molecular Weight | 517.07 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | [[4-[(3R,5S)-4-(4-chlorobenzoyl)-3,5-dimethylpiperazin-1-yl]-5-fluoro-2-pyrrolidin-1-ylphenyl]methylideneamino]thiourea |
| SMILES | C[C@@H]1CN(c2cc(N3CCCC3)c(C=NNC(N)=S)cc2F)C[C@H](C)N1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H30ClFN6OS/c1-16-14-32(15-17(2)33(16)24(34)18-5-7-20(26)8-6-18)23-12-22(31-9-3-4-10-31)19(11-21(23)27)13-29-30-25(28)35/h5-8,11-13,16-17H,3-4,9-10,14-15H2,1-2H3,(H3,28,30,35)/t16-,17+ |
| InChIKey | DWCVMKBWLKVEEJ-CALCHBBNSA-N |
| XLogP | 3.99 |
| TPSA | 77.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.07 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|