C24H30ClFN6S — CID 76572524
[[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-5-fluoro-2-piperidin-1-ylphenyl]methylideneamino]thiourea (PubChem CID 76572524) has the molecular formula C24H30ClFN6S and a molecular weight of 489.06 g/mol. Its IUPAC name is [[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-5-fluoro-2-piperidin-1-ylphenyl]methylideneamino]thiourea.
| Compound Name | [[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-5-fluoro-2-piperidin-1-ylphenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76572524 |
| Molecular Formula | C24H30ClFN6S |
| Molecular Weight | 489.06 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | [[4-[4-[(2-chlorophenyl)methyl]piperazin-1-yl]-5-fluoro-2-piperidin-1-ylphenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(F)c(N2CCN(Cc3ccccc3Cl)CC2)cc1N1CCCCC1 |
| InChI | InChI=1S/C24H30ClFN6S/c25-20-7-3-2-6-18(20)17-30-10-12-32(13-11-30)23-15-22(31-8-4-1-5-9-31)19(14-21(23)26)16-28-29-24(27)33/h2-3,6-7,14-16H,1,4-5,8-13,17H2,(H3,27,29,33) |
| InChIKey | ITQANBCMCNIUBR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 60.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.06 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|