C20H20Cl2F3N5S — CID 76572033
[[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2-(trifluoromethyl)phenyl]methylideneamino]thiourea (PubChem CID 76572033) has the molecular formula C20H20Cl2F3N5S and a molecular weight of 490.38 g/mol. Its IUPAC name is [[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2-(trifluoromethyl)phenyl]methylideneamino]thiourea.
| Compound Name | [[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2-(trifluoromethyl)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76572033 |
| Molecular Formula | C20H20Cl2F3N5S |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | [[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2-(trifluoromethyl)phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc(N2CCN(Cc3ccc(Cl)cc3Cl)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H20Cl2F3N5S/c21-15-3-1-14(18(22)9-15)12-29-5-7-30(8-6-29)16-4-2-13(11-27-28-19(26)31)17(10-16)20(23,24)25/h1-4,9-11H,5-8,12H2,(H3,26,28,31) |
| InChIKey | NCJRSVXBWGOCJV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|