C19H19Cl2F2N5S — CID 76572404
[[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2,3-difluorophenyl]methylideneamino]thiourea (PubChem CID 76572404) has the molecular formula C19H19Cl2F2N5S and a molecular weight of 458.37 g/mol. Its IUPAC name is [[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2,3-difluorophenyl]methylideneamino]thiourea.
| Compound Name | [[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2,3-difluorophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76572404 |
| Molecular Formula | C19H19Cl2F2N5S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | [[4-[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]-2,3-difluorophenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc(N2CCN(Cc3ccc(Cl)cc3Cl)CC2)c(F)c1F |
| InChI | InChI=1S/C19H19Cl2F2N5S/c20-14-3-1-13(15(21)9-14)11-27-5-7-28(8-6-27)16-4-2-12(17(22)18(16)23)10-25-26-19(24)29/h1-4,9-10H,5-8,11H2,(H3,24,26,29) |
| InChIKey | LPLFTKAKDQPVOO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|