C20H21ClF3N5S — CID 90866303
[[3-[4-[(2-chloro-6-fluorophenyl)methyl]-1,4-diazepan-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea (PubChem CID 90866303) has the molecular formula C20H21ClF3N5S and a molecular weight of 455.94 g/mol. Its IUPAC name is [[3-[4-[(2-chloro-6-fluorophenyl)methyl]-1,4-diazepan-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea.
| Compound Name | [[3-[4-[(2-chloro-6-fluorophenyl)methyl]-1,4-diazepan-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 90866303 |
| Molecular Formula | C20H21ClF3N5S |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | [[3-[4-[(2-chloro-6-fluorophenyl)methyl]-1,4-diazepan-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(F)cc(N2CCCN(Cc3c(F)cccc3Cl)CC2)c1F |
| InChI | InChI=1S/C20H21ClF3N5S/c21-16-3-1-4-17(23)15(16)12-28-5-2-6-29(8-7-28)18-10-14(22)9-13(19(18)24)11-26-27-20(25)30/h1,3-4,9-11H,2,5-8,12H2,(H3,25,27,30) |
| InChIKey | GNVVOTJSIZXSAB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|