C18H21ClFN5OS — CID 76572479
[[5-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]furan-2-yl]methylideneamino]thiourea (PubChem CID 76572479) has the molecular formula C18H21ClFN5OS and a molecular weight of 409.92 g/mol. Its IUPAC name is [[5-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]furan-2-yl]methylideneamino]thiourea.
| Compound Name | [[5-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]furan-2-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76572479 |
| Molecular Formula | C18H21ClFN5OS |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [[5-[[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]methyl]furan-2-yl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc(CN2CCN(Cc3c(F)cccc3Cl)CC2)o1 |
| InChI | InChI=1S/C18H21ClFN5OS/c19-16-2-1-3-17(20)15(16)12-25-8-6-24(7-9-25)11-14-5-4-13(26-14)10-22-23-18(21)27/h1-5,10H,6-9,11-12H2,(H3,21,23,27) |
| InChIKey | MXRRWNRRCPETIF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|