C17H20ClN5OS — CID 76572534
[[5-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]furan-2-yl]methylideneamino]thiourea (PubChem CID 76572534) has the molecular formula C17H20ClN5OS and a molecular weight of 377.90 g/mol. Its IUPAC name is [[5-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]furan-2-yl]methylideneamino]thiourea.
| Compound Name | [[5-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]furan-2-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76572534 |
| Molecular Formula | C17H20ClN5OS |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [[5-[[4-(2-chlorophenyl)piperazin-1-yl]methyl]furan-2-yl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc(CN2CCN(c3ccccc3Cl)CC2)o1 |
| InChI | InChI=1S/C17H20ClN5OS/c18-15-3-1-2-4-16(15)23-9-7-22(8-10-23)12-14-6-5-13(24-14)11-20-21-17(19)25/h1-6,11H,7-10,12H2,(H3,19,21,25) |
| InChIKey | BDPNXMGBYHJOTG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|