About [[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea
[[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea (PubChem CID 76572167) has the molecular formula C21H24F3N5S
and a molecular weight of 435.52 g/mol. Its IUPAC name is [[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea.
Molecular Properties
| Compound Name | [[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea |
| PubChem CID | 76572167 |
| Molecular Formula | C21H24F3N5S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc(N2CCCN(Cc3ccccc3)CC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H24F3N5S/c22-21(23,24)18-13-17(14-26-27-20(25)30)7-8-19(18)29-10-4-9-28(11-12-29)15-16-5-2-1-3-6-16/h1-3,5-8,13-14H,4,9-12,15H2,(H3,25,27,30) |
| InChIKey | CLAZAHYINSUOHF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea?
The IUPAC name of [[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea (CID 76572167) is [[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea.
What is the SMILES notation for [[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea?
The canonical SMILES for [[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea is NC(=S)NN=Cc1ccc(N2CCCN(Cc3ccccc3)CC2)c(C(F)(F)F)c1.
What is the InChIKey of [[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea?
The InChIKey is CLAZAHYINSUOHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F3N5S/c22-21(23,24)18-13-17(14-26-27-20(25)30)7-8-19(18)29-10-4-9-28(11-12-29)15-16-5-2-1-3-6-16/h1-3,5-8,13-14H,4,9-12,15H2,(H3,25,27,30).
What are the key properties of [[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea?
[[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea has a molecular weight of 435.52 g/mol, XLogP of 3.58, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[4-(4-benzyl-1,4-diazepan-1-yl)-3-(trifluoromethyl)phenyl]methylideneamino]thiourea is sourced from PubChem (CID 76572167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).