C18H21ClN6S — CID 76571919
[[3-chloro-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea (PubChem CID 76571919) has the molecular formula C18H21ClN6S and a molecular weight of 388.93 g/mol. Its IUPAC name is [[3-chloro-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[3-chloro-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76571919 |
| Molecular Formula | C18H21ClN6S |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [[3-chloro-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc(N2CCN(Cc3ccccn3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H21ClN6S/c19-16-11-14(12-22-23-18(20)26)4-5-17(16)25-9-7-24(8-10-25)13-15-3-1-2-6-21-15/h1-6,11-12H,7-10,13H2,(H3,20,23,26) |
| InChIKey | ZZVNCTCQQWZGCG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|