C20H24ClN5S — CID 76572291
[[2-chloro-4-[4-(1-phenylethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea (PubChem CID 76572291) has the molecular formula C20H24ClN5S and a molecular weight of 401.97 g/mol. Its IUPAC name is [[2-chloro-4-[4-(1-phenylethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[2-chloro-4-[4-(1-phenylethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76572291 |
| Molecular Formula | C20H24ClN5S |
| Molecular Weight | 401.97 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [[2-chloro-4-[4-(1-phenylethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea |
| SMILES | CC(c1ccccc1)N1CCN(c2ccc(C=NNC(N)=S)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H24ClN5S/c1-15(16-5-3-2-4-6-16)25-9-11-26(12-10-25)18-8-7-17(19(21)13-18)14-23-24-20(22)27/h2-8,13-15H,9-12H2,1H3,(H3,22,24,27) |
| InChIKey | XIPXGEGPZBFAMF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.97 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|