C17H24ClN5O2S — CID 168535351
tert-butyl 4-[4-[(carbamothioylhydrazinylidene)methyl]-3-chlorophenyl]piperazine-1-carboxylate (PubChem CID 168535351) has the molecular formula C17H24ClN5O2S and a molecular weight of 397.93 g/mol. Its IUPAC name is tert-butyl 4-[4-[(carbamothioylhydrazinylidene)methyl]-3-chlorophenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(carbamothioylhydrazinylidene)methyl]-3-chlorophenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168535351 |
| Molecular Formula | C17H24ClN5O2S |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | tert-butyl 4-[4-[(carbamothioylhydrazinylidene)methyl]-3-chlorophenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C=NNC(N)=S)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H24ClN5O2S/c1-17(2,3)25-16(24)23-8-6-22(7-9-23)13-5-4-12(14(18)10-13)11-20-21-15(19)26/h4-5,10-11H,6-9H2,1-3H3,(H3,19,21,26) |
| InChIKey | HQGQWXUWNZZQNR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|