C21H25F2N5S — CID 90746691
[[2,5-difluoro-4-[(3R)-3-phenyl-4-propan-2-ylpiperazin-1-yl]phenyl]methylideneamino]thiourea (PubChem CID 90746691) has the molecular formula C21H25F2N5S and a molecular weight of 417.53 g/mol. Its IUPAC name is [[2,5-difluoro-4-[(3R)-3-phenyl-4-propan-2-ylpiperazin-1-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[2,5-difluoro-4-[(3R)-3-phenyl-4-propan-2-ylpiperazin-1-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 90746691 |
| Molecular Formula | C21H25F2N5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | [[2,5-difluoro-4-[(3R)-3-phenyl-4-propan-2-ylpiperazin-1-yl]phenyl]methylideneamino]thiourea |
| SMILES | CC(C)N1CCN(c2cc(F)c(C=NNC(N)=S)cc2F)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H25F2N5S/c1-14(2)28-9-8-27(13-20(28)15-6-4-3-5-7-15)19-11-17(22)16(10-18(19)23)12-25-26-21(24)29/h3-7,10-12,14,20H,8-9,13H2,1-2H3,(H3,24,26,29)/t20-/m0/s1 |
| InChIKey | VUIFGKHWNHUHSE-FQEVSTJZSA-N |
| XLogP | 3.40 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|