C27H29F2N5OS — CID 91242614
[[4-[(3R)-4-benzyl-3-(phenylmethoxymethyl)piperazin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea (PubChem CID 91242614) has the molecular formula C27H29F2N5OS and a molecular weight of 509.63 g/mol. Its IUPAC name is [[4-[(3R)-4-benzyl-3-(phenylmethoxymethyl)piperazin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea.
| Compound Name | [[4-[(3R)-4-benzyl-3-(phenylmethoxymethyl)piperazin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 91242614 |
| Molecular Formula | C27H29F2N5OS |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | [[4-[(3R)-4-benzyl-3-(phenylmethoxymethyl)piperazin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(F)c(N2CCN(Cc3ccccc3)[C@@H](COCc3ccccc3)C2)cc1F |
| InChI | InChI=1S/C27H29F2N5OS/c28-24-14-26(25(29)13-22(24)15-31-32-27(30)36)34-12-11-33(16-20-7-3-1-4-8-20)23(17-34)19-35-18-21-9-5-2-6-10-21/h1-10,13-15,23H,11-12,16-19H2,(H3,30,32,36)/t23-/m1/s1 |
| InChIKey | SIEZEJSOOLNQSE-HSZRJFAPSA-N |
| XLogP | 4.04 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|