C23H27Cl2F2N5S — CID 91165637
[[4-[(3S)-4-[(2,5-dichlorophenyl)methyl]-3-(2-methylpropyl)piperazin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea (PubChem CID 91165637) has the molecular formula C23H27Cl2F2N5S and a molecular weight of 514.47 g/mol. Its IUPAC name is [[4-[(3S)-4-[(2,5-dichlorophenyl)methyl]-3-(2-methylpropyl)piperazin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea.
| Compound Name | [[4-[(3S)-4-[(2,5-dichlorophenyl)methyl]-3-(2-methylpropyl)piperazin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 91165637 |
| Molecular Formula | C23H27Cl2F2N5S |
| Molecular Weight | 514.47 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | [[4-[(3S)-4-[(2,5-dichlorophenyl)methyl]-3-(2-methylpropyl)piperazin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea |
| SMILES | CC(C)C[C@H]1CN(c2cc(F)c(C=NNC(N)=S)cc2F)CCN1Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H27Cl2F2N5S/c1-14(2)7-18-13-32(6-5-31(18)12-16-8-17(24)3-4-19(16)25)22-10-20(26)15(9-21(22)27)11-29-30-23(28)33/h3-4,8-11,14,18H,5-7,12-13H2,1-2H3,(H3,28,30,33)/t18-/m0/s1 |
| InChIKey | PHZJANDHECRNTQ-SFHVURJKSA-N |
| XLogP | 5.18 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|