C25H24F3N5S — CID 90930684
[[2,5-difluoro-4-[(3R)-4-[(4-fluorophenyl)methyl]-3-phenylpiperazin-1-yl]phenyl]methylideneamino]thiourea (PubChem CID 90930684) has the molecular formula C25H24F3N5S and a molecular weight of 483.56 g/mol. Its IUPAC name is [[2,5-difluoro-4-[(3R)-4-[(4-fluorophenyl)methyl]-3-phenylpiperazin-1-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[2,5-difluoro-4-[(3R)-4-[(4-fluorophenyl)methyl]-3-phenylpiperazin-1-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 90930684 |
| Molecular Formula | C25H24F3N5S |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | [[2,5-difluoro-4-[(3R)-4-[(4-fluorophenyl)methyl]-3-phenylpiperazin-1-yl]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(F)c(N2CCN(Cc3ccc(F)cc3)[C@H](c3ccccc3)C2)cc1F |
| InChI | InChI=1S/C25H24F3N5S/c26-20-8-6-17(7-9-20)15-32-10-11-33(16-24(32)18-4-2-1-3-5-18)23-13-21(27)19(12-22(23)28)14-30-31-25(29)34/h1-9,12-14,24H,10-11,15-16H2,(H3,29,31,34)/t24-/m0/s1 |
| InChIKey | VZXAKCVAZWFZIH-DEOSSOPVSA-N |
| XLogP | 4.33 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|