C23H29F2N5S — CID 91288592
[[4-[(3S)-3-benzyl-4-(2-methylpropyl)piperazin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea (PubChem CID 91288592) has the molecular formula C23H29F2N5S and a molecular weight of 445.58 g/mol. Its IUPAC name is [[4-[(3S)-3-benzyl-4-(2-methylpropyl)piperazin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea.
| Compound Name | [[4-[(3S)-3-benzyl-4-(2-methylpropyl)piperazin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 91288592 |
| Molecular Formula | C23H29F2N5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | [[4-[(3S)-3-benzyl-4-(2-methylpropyl)piperazin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea |
| SMILES | CC(C)CN1CCN(c2cc(F)c(C=NNC(N)=S)cc2F)C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H29F2N5S/c1-16(2)14-29-8-9-30(15-19(29)10-17-6-4-3-5-7-17)22-12-20(24)18(11-21(22)25)13-27-28-23(26)31/h3-7,11-13,16,19H,8-10,14-15H2,1-2H3,(H3,26,28,31)/t19-/m0/s1 |
| InChIKey | IQZQURZSJSCSPC-IBGZPJMESA-N |
| XLogP | 3.52 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|