C21H24F2N4S — CID 90935758
[[4-[[(1R)-3-benzylcyclopentyl]-methylamino]-2,5-difluorophenyl]methylideneamino]thiourea (PubChem CID 90935758) has the molecular formula C21H24F2N4S and a molecular weight of 402.51 g/mol. Its IUPAC name is [[4-[[(1R)-3-benzylcyclopentyl]-methylamino]-2,5-difluorophenyl]methylideneamino]thiourea.
| Compound Name | [[4-[[(1R)-3-benzylcyclopentyl]-methylamino]-2,5-difluorophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 90935758 |
| Molecular Formula | C21H24F2N4S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [[4-[[(1R)-3-benzylcyclopentyl]-methylamino]-2,5-difluorophenyl]methylideneamino]thiourea |
| SMILES | CN(c1cc(F)c(C=NNC(N)=S)cc1F)[C@@H]1CCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H24F2N4S/c1-27(17-8-7-15(10-17)9-14-5-3-2-4-6-14)20-12-18(22)16(11-19(20)23)13-25-26-21(24)28/h2-6,11-13,15,17H,7-10H2,1H3,(H3,24,26,28)/t15?,17-/m1/s1 |
| InChIKey | XDWXRVYOIWYMJX-OMOCHNIRSA-N |
| XLogP | 3.98 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|