C19H21F2N5S — CID 142921624
[(E)-[4-[2-(anilinomethyl)pyrrolidin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea (PubChem CID 142921624) has the molecular formula C19H21F2N5S and a molecular weight of 389.48 g/mol. Its IUPAC name is [(E)-[4-[2-(anilinomethyl)pyrrolidin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea.
| Compound Name | [(E)-[4-[2-(anilinomethyl)pyrrolidin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 142921624 |
| Molecular Formula | C19H21F2N5S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | [(E)-[4-[2-(anilinomethyl)pyrrolidin-1-yl]-2,5-difluorophenyl]methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/c1cc(F)c(N2CCCC2CNc2ccccc2)cc1F |
| InChI | InChI=1S/C19H21F2N5S/c20-16-10-18(17(21)9-13(16)11-24-25-19(22)27)26-8-4-7-15(26)12-23-14-5-2-1-3-6-14/h1-3,5-6,9-11,15,23H,4,7-8,12H2,(H3,22,25,27)/b24-11+ |
| InChIKey | KRLSLADPWGHJCR-BHGWPJFGSA-N |
| XLogP | 3.21 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|