C20H21F2N5S — CID 91089075
[[4-[(1S,4S)-5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,5-difluorophenyl]methylideneamino]thiourea (PubChem CID 91089075) has the molecular formula C20H21F2N5S and a molecular weight of 401.49 g/mol. Its IUPAC name is [[4-[(1S,4S)-5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,5-difluorophenyl]methylideneamino]thiourea.
| Compound Name | [[4-[(1S,4S)-5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,5-difluorophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 91089075 |
| Molecular Formula | C20H21F2N5S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [[4-[(1S,4S)-5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-2,5-difluorophenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(F)c(N2C[C@@H]3C[C@H]2CN3Cc2ccccc2)cc1F |
| InChI | InChI=1S/C20H21F2N5S/c21-17-8-19(18(22)6-14(17)9-24-25-20(23)28)27-12-15-7-16(27)11-26(15)10-13-4-2-1-3-5-13/h1-6,8-9,15-16H,7,10-12H2,(H3,23,25,28)/t15-,16-/m0/s1 |
| InChIKey | VKJHIHIGKQRURH-HOTGVXAUSA-N |
| XLogP | 2.60 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|