C20H22FN5S — CID 142921613
[(E)-[4-[(1S)-5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-fluorophenyl]methylideneamino]thiourea (PubChem CID 142921613) has the molecular formula C20H22FN5S and a molecular weight of 383.50 g/mol. Its IUPAC name is [(E)-[4-[(1S)-5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-fluorophenyl]methylideneamino]thiourea.
| Compound Name | [(E)-[4-[(1S)-5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-fluorophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 142921613 |
| Molecular Formula | C20H22FN5S |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | [(E)-[4-[(1S)-5-benzyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]-3-fluorophenyl]methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/c1ccc(N2CC3C[C@H]2CN3Cc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C20H22FN5S/c21-18-8-15(10-23-24-20(22)27)6-7-19(18)26-13-16-9-17(26)12-25(16)11-14-4-2-1-3-5-14/h1-8,10,16-17H,9,11-13H2,(H3,22,24,27)/b23-10+/t16?,17-/m0/s1 |
| InChIKey | ATPCXROQVOGUFX-VIQALZKRSA-N |
| XLogP | 2.46 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|