C27H28F3N5OS — CID 91140286
[[2,5-difluoro-4-[(3R)-4-[(4-fluorophenyl)methyl]-3-(phenylmethoxymethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea (PubChem CID 91140286) has the molecular formula C27H28F3N5OS and a molecular weight of 527.62 g/mol. Its IUPAC name is [[2,5-difluoro-4-[(3R)-4-[(4-fluorophenyl)methyl]-3-(phenylmethoxymethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[2,5-difluoro-4-[(3R)-4-[(4-fluorophenyl)methyl]-3-(phenylmethoxymethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 91140286 |
| Molecular Formula | C27H28F3N5OS |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | [[2,5-difluoro-4-[(3R)-4-[(4-fluorophenyl)methyl]-3-(phenylmethoxymethyl)piperazin-1-yl]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(F)c(N2CCN(Cc3ccc(F)cc3)[C@@H](COCc3ccccc3)C2)cc1F |
| InChI | InChI=1S/C27H28F3N5OS/c28-22-8-6-19(7-9-22)15-34-10-11-35(16-23(34)18-36-17-20-4-2-1-3-5-20)26-13-24(29)21(12-25(26)30)14-32-33-27(31)37/h1-9,12-14,23H,10-11,15-18H2,(H3,31,33,37)/t23-/m1/s1 |
| InChIKey | NQJNMUAEQPSJJR-HSZRJFAPSA-N |
| XLogP | 4.18 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|