C19H19Cl2FN4O — CID 170856300
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide (PubChem CID 170856300) has the molecular formula C19H19Cl2FN4O and a molecular weight of 409.29 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 170856300 |
| Molecular Formula | C19H19Cl2FN4O |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-2-[4-(4-fluorophenyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2ccc(F)cc2)CC1)N/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19Cl2FN4O/c20-15-2-1-14(18(21)11-15)12-23-24-19(27)13-25-7-9-26(10-8-25)17-5-3-16(22)4-6-17/h1-6,11-12H,7-10,13H2,(H,24,27)/b23-12+ |
| InChIKey | WZUARZCUJHRWPH-FSJBWODESA-N |
| XLogP | 3.40 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|