C23H35FN6S — CID 91411054
[[4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluorophenyl]methylideneamino]thiourea (PubChem CID 91411054) has the molecular formula C23H35FN6S and a molecular weight of 446.64 g/mol. Its IUPAC name is [[4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluorophenyl]methylideneamino]thiourea.
| Compound Name | [[4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluorophenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 91411054 |
| Molecular Formula | C23H35FN6S |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | [[4-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluorophenyl]methylideneamino]thiourea |
| SMILES | CN(C)[C@@H]1CCN(c2cc(N3CC[C@@H]4CCCC[C@@H]4C3)c(F)cc2C=NNC(N)=S)C1 |
| InChI | InChI=1S/C23H35FN6S/c1-28(2)19-8-10-30(15-19)21-12-22(20(24)11-18(21)13-26-27-23(25)31)29-9-7-16-5-3-4-6-17(16)14-29/h11-13,16-17,19H,3-10,14-15H2,1-2H3,(H3,25,27,31)/t16-,17+,19+/m0/s1 |
| InChIKey | HQIGGXNGCQTHQK-YQVWRLOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|