C26H35FN6S — CID 91265250
[[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluoro-4-[4-(3-methylphenyl)piperidin-1-yl]phenyl]methylideneamino]thiourea (PubChem CID 91265250) has the molecular formula C26H35FN6S and a molecular weight of 482.67 g/mol. Its IUPAC name is [[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluoro-4-[4-(3-methylphenyl)piperidin-1-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluoro-4-[4-(3-methylphenyl)piperidin-1-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 91265250 |
| Molecular Formula | C26H35FN6S |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | [[2-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-5-fluoro-4-[4-(3-methylphenyl)piperidin-1-yl]phenyl]methylideneamino]thiourea |
| SMILES | Cc1cccc(C2CCN(c3cc(N4CC[C@@H](N(C)C)C4)c(C=NNC(N)=S)cc3F)CC2)c1 |
| InChI | InChI=1S/C26H35FN6S/c1-18-5-4-6-20(13-18)19-7-10-32(11-8-19)25-15-24(33-12-9-22(17-33)31(2)3)21(14-23(25)27)16-29-30-26(28)34/h4-6,13-16,19,22H,7-12,17H2,1-3H3,(H3,28,30,34)/t22-/m1/s1 |
| InChIKey | FXWFSJIQOOMKQJ-JOCHJYFZSA-N |
| XLogP | 3.83 |
| TPSA | 60.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|