C28H35F4N7OS — CID 76571970
[[5-fluoro-2-[4-(oxolan-2-ylmethyl)piperazin-1-yl]-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]methylideneamino]thiourea (PubChem CID 76571970) has the molecular formula C28H35F4N7OS and a molecular weight of 593.70 g/mol. Its IUPAC name is [[5-fluoro-2-[4-(oxolan-2-ylmethyl)piperazin-1-yl]-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]methylideneamino]thiourea.
| Compound Name | [[5-fluoro-2-[4-(oxolan-2-ylmethyl)piperazin-1-yl]-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 76571970 |
| Molecular Formula | C28H35F4N7OS |
| Molecular Weight | 593.70 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | [[5-fluoro-2-[4-(oxolan-2-ylmethyl)piperazin-1-yl]-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(F)c(N2CCN(c3cccc(C(F)(F)F)c3)CC2)cc1N1CCN(CC2CCCO2)CC1 |
| InChI | InChI=1S/C28H35F4N7OS/c29-24-15-20(18-34-35-27(33)41)25(38-8-6-36(7-9-38)19-23-5-2-14-40-23)17-26(24)39-12-10-37(11-13-39)22-4-1-3-21(16-22)28(30,31)32/h1,3-4,15-18,23H,2,5-14,19H2,(H3,33,35,41) |
| InChIKey | IACCSGPOTFCALM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|