C24H27F3N4O3 — CID 94081226
3-[[N-[[(2S)-oxolan-2-yl]methyl]-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid (PubChem CID 94081226) has the molecular formula C24H27F3N4O3 and a molecular weight of 476.50 g/mol. Its IUPAC name is 3-[[N-[[(2S)-oxolan-2-yl]methyl]-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid.
| Compound Name | 3-[[N-[[(2S)-oxolan-2-yl]methyl]-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 94081226 |
| Molecular Formula | C24H27F3N4O3 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 3-[[N-[[(2S)-oxolan-2-yl]methyl]-C-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(N/C(=N/C[C@@H]2CCCO2)N2CCN(c3cccc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C24H27F3N4O3/c25-24(26,27)18-5-2-7-20(15-18)30-9-11-31(12-10-30)23(28-16-21-8-3-13-34-21)29-19-6-1-4-17(14-19)22(32)33/h1-2,4-7,14-15,21H,3,8-13,16H2,(H,28,29)(H,32,33)/t21-/m0/s1 |
| InChIKey | QZDBCUWHMLUAQQ-NRFANRHFSA-N |
| XLogP | 4.17 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|