C25H30N4O5 — CID 50800934
3-[[C-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid (PubChem CID 50800934) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 3-[[C-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid.
| Compound Name | 3-[[C-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 50800934 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 3-[[C-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(N/C(=N/CC2CCCO2)N2CCN(Cc3ccc4c(c3)OCO4)CC2)c1 |
| InChI | InChI=1S/C25H30N4O5/c30-24(31)19-3-1-4-20(14-19)27-25(26-15-21-5-2-12-32-21)29-10-8-28(9-11-29)16-18-6-7-22-23(13-18)34-17-33-22/h1,3-4,6-7,13-14,21H,2,5,8-12,15-17H2,(H,26,27)(H,30,31) |
| InChIKey | AUZGIBUCZXPHJZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|