C23H33N5O4 — CID 94081246
3-[[N-[[(2S)-oxolan-2-yl]methyl]-C-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]carbonimidoyl]amino]benzoic acid (PubChem CID 94081246) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is 3-[[N-[[(2S)-oxolan-2-yl]methyl]-C-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]carbonimidoyl]amino]benzoic acid.
| Compound Name | 3-[[N-[[(2S)-oxolan-2-yl]methyl]-C-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 94081246 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 3-[[N-[[(2S)-oxolan-2-yl]methyl]-C-[4-(2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]carbonimidoyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(N/C(=N/C[C@@H]2CCCO2)N2CCN(CC(=O)N3CCCC3)CC2)c1 |
| InChI | InChI=1S/C23H33N5O4/c29-21(27-8-1-2-9-27)17-26-10-12-28(13-11-26)23(24-16-20-7-4-14-32-20)25-19-6-3-5-18(15-19)22(30)31/h3,5-6,15,20H,1-2,4,7-14,16-17H2,(H,24,25)(H,30,31)/t20-/m0/s1 |
| InChIKey | SSRVXMCPAOULQM-FQEVSTJZSA-N |
| XLogP | 1.57 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|