C23H27ClN4O3 — CID 50801073
3-[[C-[4-(2-chlorophenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid (PubChem CID 50801073) has the molecular formula C23H27ClN4O3 and a molecular weight of 442.95 g/mol. Its IUPAC name is 3-[[C-[4-(2-chlorophenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid.
| Compound Name | 3-[[C-[4-(2-chlorophenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 50801073 |
| Molecular Formula | C23H27ClN4O3 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 3-[[C-[4-(2-chlorophenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(N/C(=N/CC2CCCO2)N2CCN(c3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C23H27ClN4O3/c24-20-8-1-2-9-21(20)27-10-12-28(13-11-27)23(25-16-19-7-4-14-31-19)26-18-6-3-5-17(15-18)22(29)30/h1-3,5-6,8-9,15,19H,4,7,10-14,16H2,(H,25,26)(H,29,30) |
| InChIKey | OIOZUWLODHEPPC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|