C24H29ClN4O3 — CID 46347764
4-[[C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid (PubChem CID 46347764) has the molecular formula C24H29ClN4O3 and a molecular weight of 456.97 g/mol. Its IUPAC name is 4-[[C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid.
| Compound Name | 4-[[C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 46347764 |
| Molecular Formula | C24H29ClN4O3 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 4-[[C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-(oxolan-2-ylmethyl)carbonimidoyl]amino]benzoic acid |
| SMILES | Cc1ccc(Cl)cc1N1CCN(/C(=N\CC2CCCO2)Nc2ccc(C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C24H29ClN4O3/c1-17-4-7-19(25)15-22(17)28-10-12-29(13-11-28)24(26-16-21-3-2-14-32-21)27-20-8-5-18(6-9-20)23(30)31/h4-9,15,21H,2-3,10-14,16H2,1H3,(H,26,27)(H,30,31) |
| InChIKey | JMKJFAWMOWPUPW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|