C28H28ClF3N4O4 — CID 146059946
4-[[N-benzyl-C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146059946) has the molecular formula C28H28ClF3N4O4 and a molecular weight of 577.00 g/mol. Its IUPAC name is 4-[[N-benzyl-C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[N-benzyl-C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146059946 |
| Molecular Formula | C28H28ClF3N4O4 |
| Molecular Weight | 577.00 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 4-[[N-benzyl-C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(Cl)cc1N1CCN(/C(=N\Cc2ccccc2)Nc2ccc(C(=O)O)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H27ClN4O2.C2HF3O2/c1-19-7-10-22(27)17-24(19)30-13-15-31(16-14-30)26(28-18-20-5-3-2-4-6-20)29-23-11-8-21(9-12-23)25(32)33;3-2(4,5)1(6)7/h2-12,17H,13-16,18H2,1H3,(H,28,29)(H,32,33);(H,6,7) |
| InChIKey | CVNYJIIOFNLMLB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.00 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|