C31H34F3N5O5 — CID 146060103
4-[[C-[4-[2-(4-methylanilino)-2-oxoethyl]piperazin-1-yl]-N-(2-phenylethyl)carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060103) has the molecular formula C31H34F3N5O5 and a molecular weight of 613.64 g/mol. Its IUPAC name is 4-[[C-[4-[2-(4-methylanilino)-2-oxoethyl]piperazin-1-yl]-N-(2-phenylethyl)carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[C-[4-[2-(4-methylanilino)-2-oxoethyl]piperazin-1-yl]-N-(2-phenylethyl)carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060103 |
| Molecular Formula | C31H34F3N5O5 |
| Molecular Weight | 613.64 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 4-[[C-[4-[2-(4-methylanilino)-2-oxoethyl]piperazin-1-yl]-N-(2-phenylethyl)carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(NC(=O)CN2CCN(/C(=N\CCc3ccccc3)Nc3ccc(C(=O)O)cc3)CC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H33N5O3.C2HF3O2/c1-22-7-11-25(12-8-22)31-27(35)21-33-17-19-34(20-18-33)29(30-16-15-23-5-3-2-4-6-23)32-26-13-9-24(10-14-26)28(36)37;3-2(4,5)1(6)7/h2-14H,15-21H2,1H3,(H,30,32)(H,31,35)(H,36,37);(H,6,7) |
| InChIKey | PJYCVEBMTXLIIZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 134.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.64 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|