C27H28FN5O3 — CID 50801198
3-[[N-benzyl-C-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid (PubChem CID 50801198) has the molecular formula C27H28FN5O3 and a molecular weight of 489.55 g/mol. Its IUPAC name is 3-[[N-benzyl-C-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid.
| Compound Name | 3-[[N-benzyl-C-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 50801198 |
| Molecular Formula | C27H28FN5O3 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 3-[[N-benzyl-C-[4-[2-(4-fluoroanilino)-2-oxoethyl]piperazin-1-yl]carbonimidoyl]amino]benzoic acid |
| SMILES | O=C(CN1CCN(/C(=N\Cc2ccccc2)Nc2cccc(C(=O)O)c2)CC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C27H28FN5O3/c28-22-9-11-23(12-10-22)30-25(34)19-32-13-15-33(16-14-32)27(29-18-20-5-2-1-3-6-20)31-24-8-4-7-21(17-24)26(35)36/h1-12,17H,13-16,18-19H2,(H,29,31)(H,30,34)(H,35,36) |
| InChIKey | YJPGEKLRXZRQMU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|