C29H30F4N4O4 — CID 146060342
3-[[C-[4-(2,5-dimethylphenyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146060342) has the molecular formula C29H30F4N4O4 and a molecular weight of 574.58 g/mol. Its IUPAC name is 3-[[C-[4-(2,5-dimethylphenyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[C-[4-(2,5-dimethylphenyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146060342 |
| Molecular Formula | C29H30F4N4O4 |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 3-[[C-[4-(2,5-dimethylphenyl)piperazin-1-yl]-N-[(4-fluorophenyl)methyl]carbonimidoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(C)c(N2CCN(/C(=N\Cc3ccc(F)cc3)Nc3cccc(C(=O)O)c3)CC2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H29FN4O2.C2HF3O2/c1-19-6-7-20(2)25(16-19)31-12-14-32(15-13-31)27(29-18-21-8-10-23(28)11-9-21)30-24-5-3-4-22(17-24)26(33)34;3-2(4,5)1(6)7/h3-11,16-17H,12-15,18H2,1-2H3,(H,29,30)(H,33,34);(H,6,7) |
| InChIKey | JTTSUMWXXAPLAS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 105.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|